C22H18Cl2N4O3S — CID 88860037
2-[(3,5-dichlorophenyl)sulfanyl-[1-(pyridin-3-ylcarbamoyl)-2,3-dihydroindol-5-yl]amino]acetic acid (PubChem CID 88860037) has the molecular formula C22H18Cl2N4O3S and a molecular weight of 489.38 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)sulfanyl-[1-(pyridin-3-ylcarbamoyl)-2,3-dihydroindol-5-yl]amino]acetic acid.
| Compound Name | 2-[(3,5-dichlorophenyl)sulfanyl-[1-(pyridin-3-ylcarbamoyl)-2,3-dihydroindol-5-yl]amino]acetic acid |
|---|---|
| PubChem CID | 88860037 |
| Molecular Formula | C22H18Cl2N4O3S |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)sulfanyl-[1-(pyridin-3-ylcarbamoyl)-2,3-dihydroindol-5-yl]amino]acetic acid |
| SMILES | O=C(O)CN(Sc1cc(Cl)cc(Cl)c1)c1ccc2c(c1)CCN2C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C22H18Cl2N4O3S/c23-15-9-16(24)11-19(10-15)32-28(13-21(29)30)18-3-4-20-14(8-18)5-7-27(20)22(31)26-17-2-1-6-25-12-17/h1-4,6,8-12H,5,7,13H2,(H,26,31)(H,29,30) |
| InChIKey | JANBFKRZRJOROT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|