C18H18N4O — CID 54564636
2,3-dimethyl-N-pyridin-3-yl-7,8-dihydropyrrolo[3,2-e]indole-6-carboxamide (PubChem CID 54564636) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is 2,3-dimethyl-N-pyridin-3-yl-7,8-dihydropyrrolo[3,2-e]indole-6-carboxamide.
| Compound Name | 2,3-dimethyl-N-pyridin-3-yl-7,8-dihydropyrrolo[3,2-e]indole-6-carboxamide |
|---|---|
| PubChem CID | 54564636 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2,3-dimethyl-N-pyridin-3-yl-7,8-dihydropyrrolo[3,2-e]indole-6-carboxamide |
| SMILES | Cc1cc2c3c(ccc2n1C)N(C(=O)Nc1cccnc1)CC3 |
| InChI | InChI=1S/C18H18N4O/c1-12-10-15-14-7-9-22(17(14)6-5-16(15)21(12)2)18(23)20-13-4-3-8-19-11-13/h3-6,8,10-11H,7,9H2,1-2H3,(H,20,23) |
| InChIKey | ZSYIGWOSJXPYML-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|