C17H16N4O — CID 54290331
3-methyl-N-pyridin-4-yl-7,8-dihydropyrrolo[3,2-e]indole-6-carboxamide (PubChem CID 54290331) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-methyl-N-pyridin-4-yl-7,8-dihydropyrrolo[3,2-e]indole-6-carboxamide.
| Compound Name | 3-methyl-N-pyridin-4-yl-7,8-dihydropyrrolo[3,2-e]indole-6-carboxamide |
|---|---|
| PubChem CID | 54290331 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-methyl-N-pyridin-4-yl-7,8-dihydropyrrolo[3,2-e]indole-6-carboxamide |
| SMILES | Cn1ccc2c3c(ccc21)N(C(=O)Nc1ccncc1)CC3 |
| InChI | InChI=1S/C17H16N4O/c1-20-10-6-13-14-7-11-21(16(14)3-2-15(13)20)17(22)19-12-4-8-18-9-5-12/h2-6,8-10H,7,11H2,1H3,(H,18,19,22) |
| InChIKey | RXBFFHSMIUPBSJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|