C19H16F3N3O — CID 54030708
1-methyl-N-[3-(trifluoromethyl)phenyl]-6,7-dihydropyrrolo[2,3-f]indole-5-carboxamide (PubChem CID 54030708) has the molecular formula C19H16F3N3O and a molecular weight of 359.35 g/mol. Its IUPAC name is 1-methyl-N-[3-(trifluoromethyl)phenyl]-6,7-dihydropyrrolo[2,3-f]indole-5-carboxamide.
| Compound Name | 1-methyl-N-[3-(trifluoromethyl)phenyl]-6,7-dihydropyrrolo[2,3-f]indole-5-carboxamide |
|---|---|
| PubChem CID | 54030708 |
| Molecular Formula | C19H16F3N3O |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 1-methyl-N-[3-(trifluoromethyl)phenyl]-6,7-dihydropyrrolo[2,3-f]indole-5-carboxamide |
| SMILES | Cn1ccc2cc3c(cc21)CCN3C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16F3N3O/c1-24-7-5-12-10-17-13(9-16(12)24)6-8-25(17)18(26)23-15-4-2-3-14(11-15)19(20,21)22/h2-5,7,9-11H,6,8H2,1H3,(H,23,26) |
| InChIKey | LFJSMEQZOFRSIR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|