C23H18F3N3O2 — CID 46384446
1-(1-benzoyl-2,3-dihydroindol-6-yl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 46384446) has the molecular formula C23H18F3N3O2 and a molecular weight of 425.41 g/mol. Its IUPAC name is 1-(1-benzoyl-2,3-dihydroindol-6-yl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(1-benzoyl-2,3-dihydroindol-6-yl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 46384446 |
| Molecular Formula | C23H18F3N3O2 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 1-(1-benzoyl-2,3-dihydroindol-6-yl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1ccc2c(c1)N(C(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C23H18F3N3O2/c24-23(25,26)17-7-4-8-18(13-17)27-22(31)28-19-10-9-15-11-12-29(20(15)14-19)21(30)16-5-2-1-3-6-16/h1-10,13-14H,11-12H2,(H2,27,28,31) |
| InChIKey | BTHQVQWGFSUYBI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |