C22H17F2N3O2 — CID 46384443
1-(1-benzoyl-2,3-dihydroindol-6-yl)-3-(2,5-difluorophenyl)urea (PubChem CID 46384443) has the molecular formula C22H17F2N3O2 and a molecular weight of 393.39 g/mol. Its IUPAC name is 1-(1-benzoyl-2,3-dihydroindol-6-yl)-3-(2,5-difluorophenyl)urea.
| Compound Name | 1-(1-benzoyl-2,3-dihydroindol-6-yl)-3-(2,5-difluorophenyl)urea |
|---|---|
| PubChem CID | 46384443 |
| Molecular Formula | C22H17F2N3O2 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 1-(1-benzoyl-2,3-dihydroindol-6-yl)-3-(2,5-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc2c(c1)N(C(=O)c1ccccc1)CC2)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C22H17F2N3O2/c23-16-7-9-18(24)19(12-16)26-22(29)25-17-8-6-14-10-11-27(20(14)13-17)21(28)15-4-2-1-3-5-15/h1-9,12-13H,10-11H2,(H2,25,26,29) |
| InChIKey | XYQYWPIMOGAXRO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |