C23H17Cl2N3OS — CID 143878899
5-[(3,5-dichlorophenyl)sulfanylamino]-N-(pyridin-2-ylmethyl)naphthalene-1-carboxamide (PubChem CID 143878899) has the molecular formula C23H17Cl2N3OS and a molecular weight of 454.38 g/mol. Its IUPAC name is 5-[(3,5-dichlorophenyl)sulfanylamino]-N-(pyridin-2-ylmethyl)naphthalene-1-carboxamide.
| Compound Name | 5-[(3,5-dichlorophenyl)sulfanylamino]-N-(pyridin-2-ylmethyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 143878899 |
| Molecular Formula | C23H17Cl2N3OS |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 5-[(3,5-dichlorophenyl)sulfanylamino]-N-(pyridin-2-ylmethyl)naphthalene-1-carboxamide |
| SMILES | O=C(NCc1ccccn1)c1cccc2c(NSc3cc(Cl)cc(Cl)c3)cccc12 |
| InChI | InChI=1S/C23H17Cl2N3OS/c24-15-11-16(25)13-18(12-15)30-28-22-9-4-6-19-20(22)7-3-8-21(19)23(29)27-14-17-5-1-2-10-26-17/h1-13,28H,14H2,(H,27,29) |
| InChIKey | IHDCEJGOBITIND-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|