C25H23Cl2N3O5S — CID 91561836
butyl 2-[(3,5-dichlorophenyl)sulfonyl-[2-(5-methyl-1,2,4-oxadiazol-3-yl)naphthalen-1-yl]amino]acetate (PubChem CID 91561836) has the molecular formula C25H23Cl2N3O5S and a molecular weight of 548.45 g/mol. Its IUPAC name is butyl 2-[(3,5-dichlorophenyl)sulfonyl-[2-(5-methyl-1,2,4-oxadiazol-3-yl)naphthalen-1-yl]amino]acetate.
| Compound Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[2-(5-methyl-1,2,4-oxadiazol-3-yl)naphthalen-1-yl]amino]acetate |
|---|---|
| PubChem CID | 91561836 |
| Molecular Formula | C25H23Cl2N3O5S |
| Molecular Weight | 548.45 g/mol |
| Exact Mass | 547.07 |
| IUPAC Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[2-(5-methyl-1,2,4-oxadiazol-3-yl)naphthalen-1-yl]amino]acetate |
| SMILES | CCCCOC(=O)CN(c1c(-c2noc(C)n2)ccc2ccccc12)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C25H23Cl2N3O5S/c1-3-4-11-34-23(31)15-30(36(32,33)20-13-18(26)12-19(27)14-20)24-21-8-6-5-7-17(21)9-10-22(24)25-28-16(2)35-29-25/h5-10,12-14H,3-4,11,15H2,1-2H3 |
| InChIKey | ANLKAEKIDNZXDX-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.45 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|