C23H20Cl2N2O4S — CID 91477631
butyl 2-[(7-cyanonaphthalen-2-yl)-(3,5-dichlorophenyl)sulfonylamino]acetate (PubChem CID 91477631) has the molecular formula C23H20Cl2N2O4S and a molecular weight of 491.40 g/mol. Its IUPAC name is butyl 2-[(7-cyanonaphthalen-2-yl)-(3,5-dichlorophenyl)sulfonylamino]acetate.
| Compound Name | butyl 2-[(7-cyanonaphthalen-2-yl)-(3,5-dichlorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 91477631 |
| Molecular Formula | C23H20Cl2N2O4S |
| Molecular Weight | 491.40 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | butyl 2-[(7-cyanonaphthalen-2-yl)-(3,5-dichlorophenyl)sulfonylamino]acetate |
| SMILES | CCCCOC(=O)CN(c1ccc2ccc(C#N)cc2c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H20Cl2N2O4S/c1-2-3-8-31-23(28)15-27(32(29,30)22-12-19(24)11-20(25)13-22)21-7-6-17-5-4-16(14-26)9-18(17)10-21/h4-7,9-13H,2-3,8,15H2,1H3 |
| InChIKey | GKWBGBIHXCKPNO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.40 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|