C28H29Cl2N5O4S2 — CID 90791541
butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-(6-thiomorpholin-4-ylpyridazin-3-yl)indol-5-yl]amino]acetate (PubChem CID 90791541) has the molecular formula C28H29Cl2N5O4S2 and a molecular weight of 634.61 g/mol. Its IUPAC name is butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-(6-thiomorpholin-4-ylpyridazin-3-yl)indol-5-yl]amino]acetate.
| Compound Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-(6-thiomorpholin-4-ylpyridazin-3-yl)indol-5-yl]amino]acetate |
|---|---|
| PubChem CID | 90791541 |
| Molecular Formula | C28H29Cl2N5O4S2 |
| Molecular Weight | 634.61 g/mol |
| Exact Mass | 633.10 |
| IUPAC Name | butyl 2-[(3,5-dichlorophenyl)sulfonyl-[1-(6-thiomorpholin-4-ylpyridazin-3-yl)indol-5-yl]amino]acetate |
| SMILES | CCCCOC(=O)CN(c1ccc2c(ccn2-c2ccc(N3CCSCC3)nn2)c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C28H29Cl2N5O4S2/c1-2-3-12-39-28(36)19-35(41(37,38)24-17-21(29)16-22(30)18-24)23-4-5-25-20(15-23)8-9-34(25)27-7-6-26(31-32-27)33-10-13-40-14-11-33/h4-9,15-18H,2-3,10-14,19H2,1H3 |
| InChIKey | IZLOYZWZIDYLLY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.61 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|