C20H23Cl2N4O6PS — CID 59446558
[(3,5-dichlorophenyl)sulfonyl-[3-(diethylcarbamoyl)-1-methylindazol-6-yl]amino]methylphosphonic acid (PubChem CID 59446558) has the molecular formula C20H23Cl2N4O6PS and a molecular weight of 549.37 g/mol. Its IUPAC name is [(3,5-dichlorophenyl)sulfonyl-[3-(diethylcarbamoyl)-1-methylindazol-6-yl]amino]methylphosphonic acid.
| Compound Name | [(3,5-dichlorophenyl)sulfonyl-[3-(diethylcarbamoyl)-1-methylindazol-6-yl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 59446558 |
| Molecular Formula | C20H23Cl2N4O6PS |
| Molecular Weight | 549.37 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | [(3,5-dichlorophenyl)sulfonyl-[3-(diethylcarbamoyl)-1-methylindazol-6-yl]amino]methylphosphonic acid |
| SMILES | CCN(CC)C(=O)c1nn(C)c2cc(N(CP(=O)(O)O)S(=O)(=O)c3cc(Cl)cc(Cl)c3)ccc12 |
| InChI | InChI=1S/C20H23Cl2N4O6PS/c1-4-25(5-2)20(27)19-17-7-6-15(11-18(17)24(3)23-19)26(12-33(28,29)30)34(31,32)16-9-13(21)8-14(22)10-16/h6-11H,4-5,12H2,1-3H3,(H2,28,29,30) |
| InChIKey | AYSUTEHSGLOVAQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|