C16H14Cl2N4O3S — CID 59335153
6-[(3,5-dichlorophenyl)sulfonylamino]-N,1-dimethylindazole-3-carboxamide (PubChem CID 59335153) has the molecular formula C16H14Cl2N4O3S and a molecular weight of 413.29 g/mol. Its IUPAC name is 6-[(3,5-dichlorophenyl)sulfonylamino]-N,1-dimethylindazole-3-carboxamide.
| Compound Name | 6-[(3,5-dichlorophenyl)sulfonylamino]-N,1-dimethylindazole-3-carboxamide |
|---|---|
| PubChem CID | 59335153 |
| Molecular Formula | C16H14Cl2N4O3S |
| Molecular Weight | 413.29 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 6-[(3,5-dichlorophenyl)sulfonylamino]-N,1-dimethylindazole-3-carboxamide |
| SMILES | CNC(=O)c1nn(C)c2cc(NS(=O)(=O)c3cc(Cl)cc(Cl)c3)ccc12 |
| InChI | InChI=1S/C16H14Cl2N4O3S/c1-19-16(23)15-13-4-3-11(8-14(13)22(2)20-15)21-26(24,25)12-6-9(17)5-10(18)7-12/h3-8,21H,1-2H3,(H,19,23) |
| InChIKey | GZJLVRUDRWJQBG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |