C30H35Cl2N3O9S — CID 59335054
tert-butyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]carbamoyl]-6-[(3,5-dichlorophenyl)sulfonylamino]indole-1-carboxylate (PubChem CID 59335054) has the molecular formula C30H35Cl2N3O9S and a molecular weight of 684.60 g/mol. Its IUPAC name is tert-butyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]carbamoyl]-6-[(3,5-dichlorophenyl)sulfonylamino]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]carbamoyl]-6-[(3,5-dichlorophenyl)sulfonylamino]indole-1-carboxylate |
|---|---|
| PubChem CID | 59335054 |
| Molecular Formula | C30H35Cl2N3O9S |
| Molecular Weight | 684.60 g/mol |
| Exact Mass | 683.15 |
| IUPAC Name | tert-butyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]carbamoyl]-6-[(3,5-dichlorophenyl)sulfonylamino]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C(=O)c1cn(C(=O)OC(C)(C)C)c2cc(NS(=O)(=O)c3cc(Cl)cc(Cl)c3)ccc12 |
| InChI | InChI=1S/C30H35Cl2N3O9S/c1-28(2,3)42-25(37)34-16-22(24(36)35(26(38)43-29(4,5)6)27(39)44-30(7,8)9)21-11-10-19(15-23(21)34)33-45(40,41)20-13-17(31)12-18(32)14-20/h10-16,33H,1-9H3 |
| InChIKey | URUJOZWTWUCAJF-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.60 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|