C14H17Cl2N3O2S — CID 25047609
N-(3-tert-butyl-1-methylpyrazol-5-yl)-3,5-dichlorobenzenesulfonamide (PubChem CID 25047609) has the molecular formula C14H17Cl2N3O2S and a molecular weight of 362.28 g/mol. Its IUPAC name is N-(3-tert-butyl-1-methylpyrazol-5-yl)-3,5-dichlorobenzenesulfonamide.
| Compound Name | N-(3-tert-butyl-1-methylpyrazol-5-yl)-3,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 25047609 |
| Molecular Formula | C14H17Cl2N3O2S |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | N-(3-tert-butyl-1-methylpyrazol-5-yl)-3,5-dichlorobenzenesulfonamide |
| SMILES | Cn1nc(C(C)(C)C)cc1NS(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2N3O2S/c1-14(2,3)12-8-13(19(4)17-12)18-22(20,21)11-6-9(15)5-10(16)7-11/h5-8,18H,1-4H3 |
| InChIKey | BKGXAURSAYQHHE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |