C15H20ClN3O2S — CID 3601933
N-(3-tert-butyl-1-methylpyrazol-5-yl)-3-chloro-4-methylbenzenesulfonamide (PubChem CID 3601933) has the molecular formula C15H20ClN3O2S and a molecular weight of 341.86 g/mol. Its IUPAC name is N-(3-tert-butyl-1-methylpyrazol-5-yl)-3-chloro-4-methylbenzenesulfonamide.
| Compound Name | N-(3-tert-butyl-1-methylpyrazol-5-yl)-3-chloro-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 3601933 |
| Molecular Formula | C15H20ClN3O2S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-(3-tert-butyl-1-methylpyrazol-5-yl)-3-chloro-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(C(C)(C)C)nn2C)cc1Cl |
| InChI | InChI=1S/C15H20ClN3O2S/c1-10-6-7-11(8-12(10)16)22(20,21)18-14-9-13(15(2,3)4)17-19(14)5/h6-9,18H,1-5H3 |
| InChIKey | NLNSRLYQJFZEKX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |