C24H25F3N2O4S2 — CID 142976524
N-hydroxy-7-[N-thiophen-2-ylsulfonyl-4-[4-(trifluoromethyl)phenyl]anilino]heptanamide (PubChem CID 142976524) has the molecular formula C24H25F3N2O4S2 and a molecular weight of 526.60 g/mol. Its IUPAC name is N-hydroxy-7-[N-thiophen-2-ylsulfonyl-4-[4-(trifluoromethyl)phenyl]anilino]heptanamide.
| Compound Name | N-hydroxy-7-[N-thiophen-2-ylsulfonyl-4-[4-(trifluoromethyl)phenyl]anilino]heptanamide |
|---|---|
| PubChem CID | 142976524 |
| Molecular Formula | C24H25F3N2O4S2 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | N-hydroxy-7-[N-thiophen-2-ylsulfonyl-4-[4-(trifluoromethyl)phenyl]anilino]heptanamide |
| SMILES | O=C(CCCCCCN(c1ccc(-c2ccc(C(F)(F)F)cc2)cc1)S(=O)(=O)c1cccs1)NO |
| InChI | InChI=1S/C24H25F3N2O4S2/c25-24(26,27)20-12-8-18(9-13-20)19-10-14-21(15-11-19)29(35(32,33)23-7-5-17-34-23)16-4-2-1-3-6-22(30)28-31/h5,7-15,17,31H,1-4,6,16H2,(H,28,30) |
| InChIKey | ALLUAGTUDBNCCG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|