C18H18N2O3S3 — CID 3236370
2-(4-methyl-N-thiophen-2-ylsulfonylanilino)-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 3236370) has the molecular formula C18H18N2O3S3 and a molecular weight of 406.55 g/mol. Its IUPAC name is 2-(4-methyl-N-thiophen-2-ylsulfonylanilino)-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(4-methyl-N-thiophen-2-ylsulfonylanilino)-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3236370 |
| Molecular Formula | C18H18N2O3S3 |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 2-(4-methyl-N-thiophen-2-ylsulfonylanilino)-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | Cc1ccc(N(CC(=O)NCc2cccs2)S(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H18N2O3S3/c1-14-6-8-15(9-7-14)20(26(22,23)18-5-3-11-25-18)13-17(21)19-12-16-4-2-10-24-16/h2-11H,12-13H2,1H3,(H,19,21) |
| InChIKey | ICWWDZDZCZKIOV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |