C19H16F2N2O3S2 — CID 15990975
N-(2,4-difluorophenyl)-2-(4-methyl-N-thiophen-2-ylsulfonylanilino)acetamide (PubChem CID 15990975) has the molecular formula C19H16F2N2O3S2 and a molecular weight of 422.48 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(4-methyl-N-thiophen-2-ylsulfonylanilino)acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(4-methyl-N-thiophen-2-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 15990975 |
| Molecular Formula | C19H16F2N2O3S2 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(4-methyl-N-thiophen-2-ylsulfonylanilino)acetamide |
| SMILES | Cc1ccc(N(CC(=O)Nc2ccc(F)cc2F)S(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C19H16F2N2O3S2/c1-13-4-7-15(8-5-13)23(28(25,26)19-3-2-10-27-19)12-18(24)22-17-9-6-14(20)11-16(17)21/h2-11H,12H2,1H3,(H,22,24) |
| InChIKey | WSBPSCVOSHOORZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |