C12H11NO5S2 — CID 60828163
2-(4-hydroxy-N-thiophen-2-ylsulfonylanilino)acetic acid (PubChem CID 60828163) has the molecular formula C12H11NO5S2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-(4-hydroxy-N-thiophen-2-ylsulfonylanilino)acetic acid.
| Compound Name | 2-(4-hydroxy-N-thiophen-2-ylsulfonylanilino)acetic acid |
|---|---|
| PubChem CID | 60828163 |
| Molecular Formula | C12H11NO5S2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 2-(4-hydroxy-N-thiophen-2-ylsulfonylanilino)acetic acid |
| SMILES | O=C(O)CN(c1ccc(O)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C12H11NO5S2/c14-10-5-3-9(4-6-10)13(8-11(15)16)20(17,18)12-2-1-7-19-12/h1-7,14H,8H2,(H,15,16) |
| InChIKey | SJQOQPXYCPEZTM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |