C16H20N2O4 — CID 23072393
(8E)-8-(1-benzofuran-2-yl)-N-hydroxy-8-hydroxyiminooctanamide (PubChem CID 23072393) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is (8E)-8-(1-benzofuran-2-yl)-N-hydroxy-8-hydroxyiminooctanamide.
| Compound Name | (8E)-8-(1-benzofuran-2-yl)-N-hydroxy-8-hydroxyiminooctanamide |
|---|---|
| PubChem CID | 23072393 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (8E)-8-(1-benzofuran-2-yl)-N-hydroxy-8-hydroxyiminooctanamide |
| SMILES | O=C(CCCCCC/C(=N\O)c1cc2ccccc2o1)NO |
| InChI | InChI=1S/C16H20N2O4/c19-16(18-21)10-4-2-1-3-8-13(17-20)15-11-12-7-5-6-9-14(12)22-15/h5-7,9,11,20-21H,1-4,8,10H2,(H,18,19)/b17-13+ |
| InChIKey | LBAPHCCTFHVQPX-GHRIWEEISA-N |
| XLogP | 3.46 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|