C20H24N2O3 — CID 10088613
(8E)-N-hydroxy-8-hydroxyimino-8-(4-phenylphenyl)octanamide (PubChem CID 10088613) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is (8E)-N-hydroxy-8-hydroxyimino-8-(4-phenylphenyl)octanamide.
| Compound Name | (8E)-N-hydroxy-8-hydroxyimino-8-(4-phenylphenyl)octanamide |
|---|---|
| PubChem CID | 10088613 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (8E)-N-hydroxy-8-hydroxyimino-8-(4-phenylphenyl)octanamide |
| SMILES | O=C(CCCCCC/C(=N\O)c1ccc(-c2ccccc2)cc1)NO |
| InChI | InChI=1S/C20H24N2O3/c23-20(22-25)11-7-2-1-6-10-19(21-24)18-14-12-17(13-15-18)16-8-4-3-5-9-16/h3-5,8-9,12-15,24-25H,1-2,6-7,10-11H2,(H,22,23)/b21-19+ |
| InChIKey | HQQVMXQBHVJZAV-XUTLUUPISA-N |
| XLogP | 4.38 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|