C12H18N2O4 — CID 74015259
8-(furan-2-yl)-N-hydroxy-8-hydroxyiminooctanamide (PubChem CID 74015259) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 8-(furan-2-yl)-N-hydroxy-8-hydroxyiminooctanamide.
| Compound Name | 8-(furan-2-yl)-N-hydroxy-8-hydroxyiminooctanamide |
|---|---|
| PubChem CID | 74015259 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 8-(furan-2-yl)-N-hydroxy-8-hydroxyiminooctanamide |
| SMILES | O=C(CCCCCCC(=NO)c1ccco1)NO |
| InChI | InChI=1S/C12H18N2O4/c15-12(14-17)8-4-2-1-3-6-10(13-16)11-7-5-9-18-11/h5,7,9,16-17H,1-4,6,8H2,(H,14,15) |
| InChIKey | OISWPMJTKBUDEZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|