C19H19NO6S — CID 139789577
(2R)-2-[[4-(1-benzofuran-2-yl)phenyl]sulfonyl-(methoxymethyl)amino]propanoic acid (PubChem CID 139789577) has the molecular formula C19H19NO6S and a molecular weight of 389.43 g/mol. Its IUPAC name is (2R)-2-[[4-(1-benzofuran-2-yl)phenyl]sulfonyl-(methoxymethyl)amino]propanoic acid.
| Compound Name | (2R)-2-[[4-(1-benzofuran-2-yl)phenyl]sulfonyl-(methoxymethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 139789577 |
| Molecular Formula | C19H19NO6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | (2R)-2-[[4-(1-benzofuran-2-yl)phenyl]sulfonyl-(methoxymethyl)amino]propanoic acid |
| SMILES | COCN([C@H](C)C(=O)O)S(=O)(=O)c1ccc(-c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C19H19NO6S/c1-13(19(21)22)20(12-25-2)27(23,24)16-9-7-14(8-10-16)18-11-15-5-3-4-6-17(15)26-18/h3-11,13H,12H2,1-2H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | JEYHLNRWKFVGAL-CYBMUJFWSA-N |
| XLogP | 3.17 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|