C21H29N3O4S — CID 141300681
N-hydroxy-7-[(4-propan-2-ylphenyl)sulfonyl-pyridin-2-ylamino]heptanamide (PubChem CID 141300681) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-hydroxy-7-[(4-propan-2-ylphenyl)sulfonyl-pyridin-2-ylamino]heptanamide.
| Compound Name | N-hydroxy-7-[(4-propan-2-ylphenyl)sulfonyl-pyridin-2-ylamino]heptanamide |
|---|---|
| PubChem CID | 141300681 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-hydroxy-7-[(4-propan-2-ylphenyl)sulfonyl-pyridin-2-ylamino]heptanamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)N(CCCCCCC(=O)NO)c2ccccn2)cc1 |
| InChI | InChI=1S/C21H29N3O4S/c1-17(2)18-11-13-19(14-12-18)29(27,28)24(20-9-6-7-15-22-20)16-8-4-3-5-10-21(25)23-26/h6-7,9,11-15,17,26H,3-5,8,10,16H2,1-2H3,(H,23,25) |
| InChIKey | LCUDKYUSEIPOQH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|