C22H31N3O4S — CID 141300682
7-[(4-butylphenyl)sulfonyl-pyridin-2-ylamino]-N-hydroxyheptanamide (PubChem CID 141300682) has the molecular formula C22H31N3O4S and a molecular weight of 433.57 g/mol. Its IUPAC name is 7-[(4-butylphenyl)sulfonyl-pyridin-2-ylamino]-N-hydroxyheptanamide.
| Compound Name | 7-[(4-butylphenyl)sulfonyl-pyridin-2-ylamino]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 141300682 |
| Molecular Formula | C22H31N3O4S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 7-[(4-butylphenyl)sulfonyl-pyridin-2-ylamino]-N-hydroxyheptanamide |
| SMILES | CCCCc1ccc(S(=O)(=O)N(CCCCCCC(=O)NO)c2ccccn2)cc1 |
| InChI | InChI=1S/C22H31N3O4S/c1-2-3-10-19-13-15-20(16-14-19)30(28,29)25(21-11-7-8-17-23-21)18-9-5-4-6-12-22(26)24-27/h7-8,11,13-17,27H,2-6,9-10,12,18H2,1H3,(H,24,26) |
| InChIKey | XTLNQDRHXNTKJI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|