C21H28N2O3 — CID 25109388
4-[4-[2-[butyl(pyridin-2-yl)amino]ethoxy]phenyl]butanoic acid (PubChem CID 25109388) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 4-[4-[2-[butyl(pyridin-2-yl)amino]ethoxy]phenyl]butanoic acid.
| Compound Name | 4-[4-[2-[butyl(pyridin-2-yl)amino]ethoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 25109388 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 4-[4-[2-[butyl(pyridin-2-yl)amino]ethoxy]phenyl]butanoic acid |
| SMILES | CCCCN(CCOc1ccc(CCCC(=O)O)cc1)c1ccccn1 |
| InChI | InChI=1S/C21H28N2O3/c1-2-3-15-23(20-8-4-5-14-22-20)16-17-26-19-12-10-18(11-13-19)7-6-9-21(24)25/h4-5,8,10-14H,2-3,6-7,9,15-17H2,1H3,(H,24,25) |
| InChIKey | UMFJXMJBMUAFEN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |