C14H21N5O2S — CID 134474549
[N-[7-(hydroxyamino)-7-oxoheptyl]-N-pyridin-2-ylcarbamimidoyl] methanimidothioate (PubChem CID 134474549) has the molecular formula C14H21N5O2S and a molecular weight of 323.42 g/mol. Its IUPAC name is [N-[7-(hydroxyamino)-7-oxoheptyl]-N-pyridin-2-ylcarbamimidoyl] methanimidothioate.
| Compound Name | [N-[7-(hydroxyamino)-7-oxoheptyl]-N-pyridin-2-ylcarbamimidoyl] methanimidothioate |
|---|---|
| PubChem CID | 134474549 |
| Molecular Formula | C14H21N5O2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | [N-[7-(hydroxyamino)-7-oxoheptyl]-N-pyridin-2-ylcarbamimidoyl] methanimidothioate |
| SMILES | [H]/N=C(\S/C=N/[H])N(CCCCCCC(=O)NO)c1ccccn1 |
| InChI | InChI=1S/C14H21N5O2S/c15-11-22-14(16)19(12-7-4-5-9-17-12)10-6-2-1-3-8-13(20)18-21/h4-5,7,9,11,15-16,21H,1-3,6,8,10H2,(H,18,20)/b15-11+,16-14- |
| InChIKey | FJUZZXFDPQVGCA-RBYPTUOBSA-N |
| XLogP | 2.62 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|