C16H24FN5O2 — CID 144623233
7-[(5-fluoro-2-pyridinyl)-[(Z)-3-(methylamino)prop-2-enimidoyl]amino]-N-hydroxyheptanamide (PubChem CID 144623233) has the molecular formula C16H24FN5O2 and a molecular weight of 337.40 g/mol. Its IUPAC name is 7-[(5-fluoro-2-pyridinyl)-[(Z)-3-(methylamino)prop-2-enimidoyl]amino]-N-hydroxyheptanamide.
| Compound Name | 7-[(5-fluoro-2-pyridinyl)-[(Z)-3-(methylamino)prop-2-enimidoyl]amino]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 144623233 |
| Molecular Formula | C16H24FN5O2 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 7-[(5-fluoro-2-pyridinyl)-[(Z)-3-(methylamino)prop-2-enimidoyl]amino]-N-hydroxyheptanamide |
| SMILES | [H]/N=C(\C=C/NC)N(CCCCCCC(=O)NO)c1ccc(F)cn1 |
| InChI | InChI=1S/C16H24FN5O2/c1-19-10-9-14(18)22(15-8-7-13(17)12-20-15)11-5-3-2-4-6-16(23)21-24/h7-10,12,18-19,24H,2-6,11H2,1H3,(H,21,23)/b10-9-,18-14+ |
| InChIKey | QOYABPUMJYHNJK-TVGYOVFCSA-N |
| XLogP | 2.19 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|