C17H18FN5O2 — CID 137256645
4-[[(5-fluoro-2-pyridinyl)-[(Z)-3-(methylamino)prop-2-enimidoyl]amino]methyl]-N-hydroxybenzamide (PubChem CID 137256645) has the molecular formula C17H18FN5O2 and a molecular weight of 343.36 g/mol. Its IUPAC name is 4-[[(5-fluoro-2-pyridinyl)-[(Z)-3-(methylamino)prop-2-enimidoyl]amino]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[(5-fluoro-2-pyridinyl)-[(Z)-3-(methylamino)prop-2-enimidoyl]amino]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 137256645 |
| Molecular Formula | C17H18FN5O2 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 4-[[(5-fluoro-2-pyridinyl)-[(Z)-3-(methylamino)prop-2-enimidoyl]amino]methyl]-N-hydroxybenzamide |
| SMILES | [H]/N=C(\C=C/NC)N(Cc1ccc(C(=O)NO)cc1)c1ccc(F)cn1 |
| InChI | InChI=1S/C17H18FN5O2/c1-20-9-8-15(19)23(16-7-6-14(18)10-21-16)11-12-2-4-13(5-3-12)17(24)22-25/h2-10,19-20,25H,11H2,1H3,(H,22,24)/b9-8-,19-15+ |
| InChIKey | SOHHRMYKQMFEAC-MSXUIQQGSA-N |
| XLogP | 2.06 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|