C24H20F6N2O2 — CID 155155767
4-[[(3-fluoro-4-methylphenyl)methyl-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]amino]methyl]-N-hydroxybenzamide (PubChem CID 155155767) has the molecular formula C24H20F6N2O2 and a molecular weight of 482.42 g/mol. Its IUPAC name is 4-[[(3-fluoro-4-methylphenyl)methyl-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]amino]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[(3-fluoro-4-methylphenyl)methyl-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]amino]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 155155767 |
| Molecular Formula | C24H20F6N2O2 |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 4-[[(3-fluoro-4-methylphenyl)methyl-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]amino]methyl]-N-hydroxybenzamide |
| SMILES | Cc1ccc(CN(CCc2c(F)c(F)c(F)c(F)c2F)Cc2ccc(C(=O)NO)cc2)cc1F |
| InChI | InChI=1S/C24H20F6N2O2/c1-13-2-3-15(10-18(13)25)12-32(11-14-4-6-16(7-5-14)24(33)31-34)9-8-17-19(26)21(28)23(30)22(29)20(17)27/h2-7,10,34H,8-9,11-12H2,1H3,(H,31,33) |
| InChIKey | RYHIJGOTULNBAW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|