C22H19BrFN3O4 — CID 112839716
5-bromo-N-[4-[2-[(3-fluoro-4-methylbenzoyl)amino]ethylcarbamoyl]phenyl]furan-2-carboxamide (PubChem CID 112839716) has the molecular formula C22H19BrFN3O4 and a molecular weight of 488.31 g/mol. Its IUPAC name is 5-bromo-N-[4-[2-[(3-fluoro-4-methylbenzoyl)amino]ethylcarbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-[2-[(3-fluoro-4-methylbenzoyl)amino]ethylcarbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 112839716 |
| Molecular Formula | C22H19BrFN3O4 |
| Molecular Weight | 488.31 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | 5-bromo-N-[4-[2-[(3-fluoro-4-methylbenzoyl)amino]ethylcarbamoyl]phenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)c2ccc(NC(=O)c3ccc(Br)o3)cc2)cc1F |
| InChI | InChI=1S/C22H19BrFN3O4/c1-13-2-3-15(12-17(13)24)21(29)26-11-10-25-20(28)14-4-6-16(7-5-14)27-22(30)18-8-9-19(23)31-18/h2-9,12H,10-11H2,1H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | QUDDDAXSCARRAR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|