C24H24BrN3O4 — CID 112841943
5-bromo-N-[4-[[4-(butylcarbamoyl)phenyl]methylcarbamoyl]phenyl]furan-2-carboxamide (PubChem CID 112841943) has the molecular formula C24H24BrN3O4 and a molecular weight of 498.38 g/mol. Its IUPAC name is 5-bromo-N-[4-[[4-(butylcarbamoyl)phenyl]methylcarbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-[[4-(butylcarbamoyl)phenyl]methylcarbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 112841943 |
| Molecular Formula | C24H24BrN3O4 |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | 5-bromo-N-[4-[[4-(butylcarbamoyl)phenyl]methylcarbamoyl]phenyl]furan-2-carboxamide |
| SMILES | CCCCNC(=O)c1ccc(CNC(=O)c2ccc(NC(=O)c3ccc(Br)o3)cc2)cc1 |
| InChI | InChI=1S/C24H24BrN3O4/c1-2-3-14-26-22(29)17-6-4-16(5-7-17)15-27-23(30)18-8-10-19(11-9-18)28-24(31)20-12-13-21(25)32-20/h4-13H,2-3,14-15H2,1H3,(H,26,29)(H,27,30)(H,28,31) |
| InChIKey | ZTHYUHXBIKCHDN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|