C19H24BrN3O3 — CID 112838026
4-[[[(5-bromofuran-2-yl)methyl-methylcarbamoyl]amino]methyl]-N-butylbenzamide (PubChem CID 112838026) has the molecular formula C19H24BrN3O3 and a molecular weight of 422.32 g/mol. Its IUPAC name is 4-[[[(5-bromofuran-2-yl)methyl-methylcarbamoyl]amino]methyl]-N-butylbenzamide.
| Compound Name | 4-[[[(5-bromofuran-2-yl)methyl-methylcarbamoyl]amino]methyl]-N-butylbenzamide |
|---|---|
| PubChem CID | 112838026 |
| Molecular Formula | C19H24BrN3O3 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 4-[[[(5-bromofuran-2-yl)methyl-methylcarbamoyl]amino]methyl]-N-butylbenzamide |
| SMILES | CCCCNC(=O)c1ccc(CNC(=O)N(C)Cc2ccc(Br)o2)cc1 |
| InChI | InChI=1S/C19H24BrN3O3/c1-3-4-11-21-18(24)15-7-5-14(6-8-15)12-22-19(25)23(2)13-16-9-10-17(20)26-16/h5-10H,3-4,11-13H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | ZZUXYGNBFCCBHR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|