C21H25Cl2N3O2 — CID 112838032
N-butyl-4-[[[(3,4-dichlorophenyl)methyl-methylcarbamoyl]amino]methyl]benzamide (PubChem CID 112838032) has the molecular formula C21H25Cl2N3O2 and a molecular weight of 422.36 g/mol. Its IUPAC name is N-butyl-4-[[[(3,4-dichlorophenyl)methyl-methylcarbamoyl]amino]methyl]benzamide.
| Compound Name | N-butyl-4-[[[(3,4-dichlorophenyl)methyl-methylcarbamoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 112838032 |
| Molecular Formula | C21H25Cl2N3O2 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | N-butyl-4-[[[(3,4-dichlorophenyl)methyl-methylcarbamoyl]amino]methyl]benzamide |
| SMILES | CCCCNC(=O)c1ccc(CNC(=O)N(C)Cc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H25Cl2N3O2/c1-3-4-11-24-20(27)17-8-5-15(6-9-17)13-25-21(28)26(2)14-16-7-10-18(22)19(23)12-16/h5-10,12H,3-4,11,13-14H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | STGCMIBTCPLYST-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|