C13H10Br3NO2 — CID 107980321
3,5-dibromo-N-[(5-bromofuran-2-yl)methyl]-N-methylbenzamide (PubChem CID 107980321) has the molecular formula C13H10Br3NO2 and a molecular weight of 451.94 g/mol. Its IUPAC name is 3,5-dibromo-N-[(5-bromofuran-2-yl)methyl]-N-methylbenzamide.
| Compound Name | 3,5-dibromo-N-[(5-bromofuran-2-yl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 107980321 |
| Molecular Formula | C13H10Br3NO2 |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 448.83 |
| IUPAC Name | 3,5-dibromo-N-[(5-bromofuran-2-yl)methyl]-N-methylbenzamide |
| SMILES | CN(Cc1ccc(Br)o1)C(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H10Br3NO2/c1-17(7-11-2-3-12(16)19-11)13(18)8-4-9(14)6-10(15)5-8/h2-6H,7H2,1H3 |
| InChIKey | LSRAFNALYHTJCE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |