C14H14Br2N2O2 — CID 60954974
4-bromo-N-[(5-bromofuran-2-yl)methyl]-1-cyclopropyl-N-methylpyrrole-2-carboxamide (PubChem CID 60954974) has the molecular formula C14H14Br2N2O2 and a molecular weight of 402.09 g/mol. Its IUPAC name is 4-bromo-N-[(5-bromofuran-2-yl)methyl]-1-cyclopropyl-N-methylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(5-bromofuran-2-yl)methyl]-1-cyclopropyl-N-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60954974 |
| Molecular Formula | C14H14Br2N2O2 |
| Molecular Weight | 402.09 g/mol |
| Exact Mass | 399.94 |
| IUPAC Name | 4-bromo-N-[(5-bromofuran-2-yl)methyl]-1-cyclopropyl-N-methylpyrrole-2-carboxamide |
| SMILES | CN(Cc1ccc(Br)o1)C(=O)c1cc(Br)cn1C1CC1 |
| InChI | InChI=1S/C14H14Br2N2O2/c1-17(8-11-4-5-13(16)20-11)14(19)12-6-9(15)7-18(12)10-2-3-10/h4-7,10H,2-3,8H2,1H3 |
| InChIKey | STIOZRNTQINQGT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.09 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |