C15H22BrN3O — CID 79318654
4-bromo-1-cyclopropyl-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]pyrrole-2-carboxamide (PubChem CID 79318654) has the molecular formula C15H22BrN3O and a molecular weight of 340.27 g/mol. Its IUPAC name is 4-bromo-1-cyclopropyl-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-cyclopropyl-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 79318654 |
| Molecular Formula | C15H22BrN3O |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 4-bromo-1-cyclopropyl-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]pyrrole-2-carboxamide |
| SMILES | CN(CC1CCCN1C)C(=O)c1cc(Br)cn1C1CC1 |
| InChI | InChI=1S/C15H22BrN3O/c1-17-7-3-4-13(17)10-18(2)15(20)14-8-11(16)9-19(14)12-5-6-12/h8-9,12-13H,3-7,10H2,1-2H3 |
| InChIKey | WLNMZGLYGHMADS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |