C11H12BrN3O2 — CID 61109003
4-amino-N-[(5-bromofuran-2-yl)methyl]-N-methyl-1H-pyrrole-2-carboxamide (PubChem CID 61109003) has the molecular formula C11H12BrN3O2 and a molecular weight of 298.14 g/mol. Its IUPAC name is 4-amino-N-[(5-bromofuran-2-yl)methyl]-N-methyl-1H-pyrrole-2-carboxamide.
| Compound Name | 4-amino-N-[(5-bromofuran-2-yl)methyl]-N-methyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61109003 |
| Molecular Formula | C11H12BrN3O2 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 4-amino-N-[(5-bromofuran-2-yl)methyl]-N-methyl-1H-pyrrole-2-carboxamide |
| SMILES | CN(Cc1ccc(Br)o1)C(=O)c1cc(N)c[nH]1 |
| InChI | InChI=1S/C11H12BrN3O2/c1-15(6-8-2-3-10(12)17-8)11(16)9-4-7(13)5-14-9/h2-5,14H,6,13H2,1H3 |
| InChIKey | LTLIMEQZGQHMGF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |