C18H18F4N2O4S — CID 155155859
N-hydroxy-4-[[2-methylpropyl-(2,3,4,5-tetrafluorophenyl)sulfonylamino]methyl]benzamide (PubChem CID 155155859) has the molecular formula C18H18F4N2O4S and a molecular weight of 434.41 g/mol. Its IUPAC name is N-hydroxy-4-[[2-methylpropyl-(2,3,4,5-tetrafluorophenyl)sulfonylamino]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[2-methylpropyl-(2,3,4,5-tetrafluorophenyl)sulfonylamino]methyl]benzamide |
|---|---|
| PubChem CID | 155155859 |
| Molecular Formula | C18H18F4N2O4S |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | N-hydroxy-4-[[2-methylpropyl-(2,3,4,5-tetrafluorophenyl)sulfonylamino]methyl]benzamide |
| SMILES | CC(C)CN(Cc1ccc(C(=O)NO)cc1)S(=O)(=O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H18F4N2O4S/c1-10(2)8-24(9-11-3-5-12(6-4-11)18(25)23-26)29(27,28)14-7-13(19)15(20)17(22)16(14)21/h3-7,10,26H,8-9H2,1-2H3,(H,23,25) |
| InChIKey | ORRALXXDFMZZIR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|