C21H22F4N2O4S — CID 167087740
3-[4-[[cyclopentyl-(2,3,4,5-tetrafluorophenyl)sulfonylamino]methyl]phenyl]-N-hydroxypropanamide (PubChem CID 167087740) has the molecular formula C21H22F4N2O4S and a molecular weight of 474.48 g/mol. Its IUPAC name is 3-[4-[[cyclopentyl-(2,3,4,5-tetrafluorophenyl)sulfonylamino]methyl]phenyl]-N-hydroxypropanamide.
| Compound Name | 3-[4-[[cyclopentyl-(2,3,4,5-tetrafluorophenyl)sulfonylamino]methyl]phenyl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 167087740 |
| Molecular Formula | C21H22F4N2O4S |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 3-[4-[[cyclopentyl-(2,3,4,5-tetrafluorophenyl)sulfonylamino]methyl]phenyl]-N-hydroxypropanamide |
| SMILES | O=C(CCc1ccc(CN(C2CCCC2)S(=O)(=O)c2cc(F)c(F)c(F)c2F)cc1)NO |
| InChI | InChI=1S/C21H22F4N2O4S/c22-16-11-17(20(24)21(25)19(16)23)32(30,31)27(15-3-1-2-4-15)12-14-7-5-13(6-8-14)9-10-18(28)26-29/h5-8,11,15,29H,1-4,9-10,12H2,(H,26,28) |
| InChIKey | VUZZEACSYISXJX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|