C17H13F5N2O3S — CID 138497943
4-[[cyclopropyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]methyl]benzamide (PubChem CID 138497943) has the molecular formula C17H13F5N2O3S and a molecular weight of 420.36 g/mol. Its IUPAC name is 4-[[cyclopropyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]methyl]benzamide.
| Compound Name | 4-[[cyclopropyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]methyl]benzamide |
|---|---|
| PubChem CID | 138497943 |
| Molecular Formula | C17H13F5N2O3S |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 4-[[cyclopropyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]methyl]benzamide |
| SMILES | NC(=O)c1ccc(CN(C2CC2)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C17H13F5N2O3S/c18-11-12(19)14(21)16(15(22)13(11)20)28(26,27)24(10-5-6-10)7-8-1-3-9(4-2-8)17(23)25/h1-4,10H,5-7H2,(H2,23,25) |
| InChIKey | PIIPWZHKHLCMLL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|