C19H19F4NO2S — CID 138498077
N-cyclobutyl-2,3,5-trifluoro-N-[(4-fluorophenyl)methyl]-4,6-dimethylbenzenesulfonamide (PubChem CID 138498077) has the molecular formula C19H19F4NO2S and a molecular weight of 401.43 g/mol. Its IUPAC name is N-cyclobutyl-2,3,5-trifluoro-N-[(4-fluorophenyl)methyl]-4,6-dimethylbenzenesulfonamide.
| Compound Name | N-cyclobutyl-2,3,5-trifluoro-N-[(4-fluorophenyl)methyl]-4,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 138498077 |
| Molecular Formula | C19H19F4NO2S |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | N-cyclobutyl-2,3,5-trifluoro-N-[(4-fluorophenyl)methyl]-4,6-dimethylbenzenesulfonamide |
| SMILES | Cc1c(F)c(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2CCC2)c(F)c1F |
| InChI | InChI=1S/C19H19F4NO2S/c1-11-16(21)12(2)19(18(23)17(11)22)27(25,26)24(15-4-3-5-15)10-13-6-8-14(20)9-7-13/h6-9,15H,3-5,10H2,1-2H3 |
| InChIKey | GOYGXSITKJOIGZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|