C14H13BrFNO2S2 — CID 26531289
5-bromo-N-cyclopropyl-N-[(4-fluorophenyl)methyl]thiophene-2-sulfonamide (PubChem CID 26531289) has the molecular formula C14H13BrFNO2S2 and a molecular weight of 390.30 g/mol. Its IUPAC name is 5-bromo-N-cyclopropyl-N-[(4-fluorophenyl)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-cyclopropyl-N-[(4-fluorophenyl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 26531289 |
| Molecular Formula | C14H13BrFNO2S2 |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 388.96 |
| IUPAC Name | 5-bromo-N-cyclopropyl-N-[(4-fluorophenyl)methyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(c1ccc(Br)s1)N(Cc1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C14H13BrFNO2S2/c15-13-7-8-14(20-13)21(18,19)17(12-5-6-12)9-10-1-3-11(16)4-2-10/h1-4,7-8,12H,5-6,9H2 |
| InChIKey | KJLDSFRZBQZNLN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |