C18H19F2NO2S — CID 166242216
N-cyclopropyl-2-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]ethanesulfonamide (PubChem CID 166242216) has the molecular formula C18H19F2NO2S and a molecular weight of 351.42 g/mol. Its IUPAC name is N-cyclopropyl-2-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]ethanesulfonamide.
| Compound Name | N-cyclopropyl-2-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 166242216 |
| Molecular Formula | C18H19F2NO2S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-cyclopropyl-2-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]ethanesulfonamide |
| SMILES | O=S(=O)(CCc1ccc(F)cc1)N(Cc1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C18H19F2NO2S/c19-16-5-1-14(2-6-16)11-12-24(22,23)21(18-9-10-18)13-15-3-7-17(20)8-4-15/h1-8,18H,9-13H2 |
| InChIKey | RRVAXEZDBGCFSQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |