C18H17ClFNO2S — CID 26531291
(E)-2-(4-chlorophenyl)-N-cyclopropyl-N-[(4-fluorophenyl)methyl]ethenesulfonamide (PubChem CID 26531291) has the molecular formula C18H17ClFNO2S and a molecular weight of 365.86 g/mol. Its IUPAC name is (E)-2-(4-chlorophenyl)-N-cyclopropyl-N-[(4-fluorophenyl)methyl]ethenesulfonamide.
| Compound Name | (E)-2-(4-chlorophenyl)-N-cyclopropyl-N-[(4-fluorophenyl)methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 26531291 |
| Molecular Formula | C18H17ClFNO2S |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | (E)-2-(4-chlorophenyl)-N-cyclopropyl-N-[(4-fluorophenyl)methyl]ethenesulfonamide |
| SMILES | O=S(=O)(/C=C/c1ccc(Cl)cc1)N(Cc1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C18H17ClFNO2S/c19-16-5-1-14(2-6-16)11-12-24(22,23)21(18-9-10-18)13-15-3-7-17(20)8-4-15/h1-8,11-12,18H,9-10,13H2/b12-11+ |
| InChIKey | OVCPPDMCMWDARY-VAWYXSNFSA-N |
| XLogP | 4.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |