C39H46ClN5O9S — CID 135779208
methyl 4-[[[1-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]pyrrolidin-3-yl]-[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]methyl]benzoate (PubChem CID 135779208) has the molecular formula C39H46ClN5O9S and a molecular weight of 796.34 g/mol. Its IUPAC name is methyl 4-[[[1-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]pyrrolidin-3-yl]-[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]methyl]benzoate.
| Compound Name | methyl 4-[[[1-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]pyrrolidin-3-yl]-[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 135779208 |
| Molecular Formula | C39H46ClN5O9S |
| Molecular Weight | 796.34 g/mol |
| Exact Mass | 795.27 |
| IUPAC Name | methyl 4-[[[1-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]pyrrolidin-3-yl]-[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C2CCN(C(=O)c3ccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc3)C2)S(=O)(=O)/C=C/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C39H46ClN5O9S/c1-38(2,3)53-36(48)42-35(43-37(49)54-39(4,5)6)41-31-18-14-28(15-19-31)33(46)44-22-20-32(25-44)45(24-27-8-12-29(13-9-27)34(47)52-7)55(50,51)23-21-26-10-16-30(40)17-11-26/h8-19,21,23,32H,20,22,24-25H2,1-7H3,(H2,41,42,43,48,49)/b23-21+ |
| InChIKey | DKKDXIGKHODWIY-XTQSDGFTSA-N |
| XLogP | 6.88 |
| TPSA | 173.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.34 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|