C25H33N3O5 — CID 142212479
benzene;tert-butyl 4-[(4-methoxycarbonylphenyl)methyl-nitrosoamino]piperidine-1-carboxylate (PubChem CID 142212479) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is benzene;tert-butyl 4-[(4-methoxycarbonylphenyl)methyl-nitrosoamino]piperidine-1-carboxylate.
| Compound Name | benzene;tert-butyl 4-[(4-methoxycarbonylphenyl)methyl-nitrosoamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142212479 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | benzene;tert-butyl 4-[(4-methoxycarbonylphenyl)methyl-nitrosoamino]piperidine-1-carboxylate |
| SMILES | COC(=O)c1ccc(CN(N=O)C2CCN(C(=O)OC(C)(C)C)CC2)cc1.c1ccccc1 |
| InChI | InChI=1S/C19H27N3O5.C6H6/c1-19(2,3)27-18(24)21-11-9-16(10-12-21)22(20-25)13-14-5-7-15(8-6-14)17(23)26-4;1-2-4-6-5-3-1/h5-8,16H,9-13H2,1-4H3;1-6H |
| InChIKey | BQEDSLHITFPZTE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|