C24H32N2O2 — CID 16724784
tert-butyl (3R)-3-[benzyl-[(1S)-1-phenylethyl]amino]pyrrolidine-1-carboxylate (PubChem CID 16724784) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is tert-butyl (3R)-3-[benzyl-[(1S)-1-phenylethyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[benzyl-[(1S)-1-phenylethyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 16724784 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | tert-butyl (3R)-3-[benzyl-[(1S)-1-phenylethyl]amino]pyrrolidine-1-carboxylate |
| SMILES | C[C@@H](c1ccccc1)N(Cc1ccccc1)[C@@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C24H32N2O2/c1-19(21-13-9-6-10-14-21)26(17-20-11-7-5-8-12-20)22-15-16-25(18-22)23(27)28-24(2,3)4/h5-14,19,22H,15-18H2,1-4H3/t19-,22+/m0/s1 |
| InChIKey | PZXYJFRYOHILHH-SIKLNZKXSA-N |
| XLogP | 5.26 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |