C29H32ClN5O3S — CID 10188033
2-[4-[3-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-(3-phenylpropyl)amino]pyrrolidine-1-carbonyl]phenyl]guanidine (PubChem CID 10188033) has the molecular formula C29H32ClN5O3S and a molecular weight of 566.13 g/mol. Its IUPAC name is 2-[4-[3-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-(3-phenylpropyl)amino]pyrrolidine-1-carbonyl]phenyl]guanidine.
| Compound Name | 2-[4-[3-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-(3-phenylpropyl)amino]pyrrolidine-1-carbonyl]phenyl]guanidine |
|---|---|
| PubChem CID | 10188033 |
| Molecular Formula | C29H32ClN5O3S |
| Molecular Weight | 566.13 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 2-[4-[3-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-(3-phenylpropyl)amino]pyrrolidine-1-carbonyl]phenyl]guanidine |
| SMILES | NC(N)=Nc1ccc(C(=O)N2CCC(N(CCCc3ccccc3)S(=O)(=O)/C=C/c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C29H32ClN5O3S/c30-25-12-8-23(9-13-25)17-20-39(37,38)35(18-4-7-22-5-2-1-3-6-22)27-16-19-34(21-27)28(36)24-10-14-26(15-11-24)33-29(31)32/h1-3,5-6,8-15,17,20,27H,4,7,16,18-19,21H2,(H4,31,32,33)/b20-17+ |
| InChIKey | MDWWSCCBERGOSI-LVZFUZTISA-N |
| XLogP | 4.39 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.13 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|