C17H17F5N2O4S — CID 155155849
2,3,4,5-tetrafluoro-N-[[2-fluoro-4-[hydroxy-(hydroxyamino)methyl]phenyl]methyl]-N-propan-2-ylbenzenesulfonamide (PubChem CID 155155849) has the molecular formula C17H17F5N2O4S and a molecular weight of 440.39 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-[[2-fluoro-4-[hydroxy-(hydroxyamino)methyl]phenyl]methyl]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-[[2-fluoro-4-[hydroxy-(hydroxyamino)methyl]phenyl]methyl]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 155155849 |
| Molecular Formula | C17H17F5N2O4S |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-[[2-fluoro-4-[hydroxy-(hydroxyamino)methyl]phenyl]methyl]-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)N(Cc1ccc(C(O)NO)cc1F)S(=O)(=O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H17F5N2O4S/c1-8(2)24(7-10-4-3-9(5-11(10)18)17(25)23-26)29(27,28)13-6-12(19)14(20)16(22)15(13)21/h3-6,8,17,23,25-26H,7H2,1-2H3 |
| InChIKey | BKJADNAKGDOJHT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|